FL5F1AGS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |Sysname=3,7,4'-Trihydroxyflavone 4'-glucoside |
|Common Name=&&Resokaempferol 4'-glucoside&& | |Common Name=&&Resokaempferol 4'-glucoside&& | ||
|CAS=24502-04-3 | |CAS=24502-04-3 | ||
|KNApSAcK=C00005129 | |KNApSAcK=C00005129 | ||
}} | }} |
Revision as of 09:00, 12 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 24502-04-3 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5F1AGS0002.mol |
Resokaempferol 4'-glucoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | |
Common Name |
|
Symbol | |
Formula | C21H20O10 |
Exact Mass | 432.10564686 |
Average Mass | 432.37749999999994 |
SMILES | c(c3)(ccc(OC(O4)C(O)C(O)C(O)C4CO)c3)C(=C2O)Oc(c1)c |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|