FL4DALNI0004
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R)-2-(2,4-Dihydroxyphenyl)-2,3-dihydro-3beta,7-dihydroxy-5-methoxy-8-[(R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-4H-1-benzopyran-4-one | + | |SysName= (2R) -2- (2,4-Dihydroxyphenyl) -2,3-dihydro-3beta,7-dihydroxy-5-methoxy-8- [ (R) -5-methyl-2- (1-methylethenyl) -4-hexenyl ] -4H-1-benzopyran-4-one |
| − | |Common Name=&&Kushenol I&&(2R)-2-(2,4-Dihydroxyphenyl)-2,3-dihydro-3beta,7-dihydroxy-5-methoxy-8-[(R)-5-methyl-2-(1-methylethenyl)-4-hexenyl]-4H-1-benzopyran-4-one&& | + | |Common Name=&&Kushenol I&& (2R) -2- (2,4-Dihydroxyphenyl) -2,3-dihydro-3beta,7-dihydroxy-5-methoxy-8- [ (R) -5-methyl-2- (1-methylethenyl) -4-hexenyl ] -4H-1-benzopyran-4-one&& |
|CAS=99119-69-4 | |CAS=99119-69-4 | ||
|KNApSAcK=C00008650 | |KNApSAcK=C00008650 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 99119-69-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL4DALNI0004.mol |
| Kushenol I | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2- (2,4-Dihydroxyphenyl) -2,3-dihydro-3beta,7-dihydroxy-5-methoxy-8- [ (R) -5-methyl-2- (1-methylethenyl) -4-hexenyl ] -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C26H30O7 |
| Exact Mass | 454.199153314 |
| Average Mass | 454.5122 |
| SMILES | COc(c1)c(C(=O)2)c(OC(c(c3)c(cc(O)c3)O)C(O)2)c(c1O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
