FL3FEANS0010
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | | | + | |SysName=9-Hydroxy-6-(4-hydroxyphenyl)-8H-1,3-dioxolo[4,5-g][1]benzopyran-8-one |
|Common Name=&&Kanzakiflavone 2&& | |Common Name=&&Kanzakiflavone 2&& | ||
|CAS=60948-17-6 | |CAS=60948-17-6 | ||
|KNApSAcK=C00004001 | |KNApSAcK=C00004001 | ||
}} | }} |
Revision as of 09:00, 13 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 60948-17-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FEANS0010.mol |
Kanzakiflavone 2 | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 9-Hydroxy-6-(4-hydroxyphenyl)-8H-1,3-dioxolo[4,5-g][1]benzopyran-8-one |
Common Name |
|
Symbol | |
Formula | C16H10O6 |
Exact Mass | 298.047738052 |
Average Mass | 298.24699999999996 |
SMILES | Oc(c4)ccc(c4)C(=C3)Oc(c1)c(C(=O)3)c(O)c(O2)c(OC2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
[show] Species-Flavonoid Relationship Reported |
---|