FL1C1ANI0022
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=3'-(2-Hydroxy-3-methylbut-3-enyl)-4,2',4'-trihydroxychalcone | + | |SysName=3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone |
− | |Common Name=&&3'-(2-Hydroxy-3-methylbut-3-enyl)-4,2',4'-trihydroxychalcone&& | + | |Common Name=&&3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone&& |
|CAS=- | |CAS=- | ||
|KNApSAcK=C00011139 | |KNApSAcK=C00011139 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | - |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1C1ANI0022.mol |
3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 3'- (2-Hydroxy-3-methylbut-3-enyl) -4,2',4'-trihydroxychalcone |
Common Name |
|
Symbol | |
Formula | C19H18O6 |
Exact Mass | 342.110338308 |
Average Mass | 342.34262 |
SMILES | c(c1C(=O)C=Cc(c2)ccc(O)c2)(c(CC(O)C(C)=O)c(O)cc1)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|