FLIC3LNS0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 101153-40-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FLIC3LNS0003.mol |
Isoduartin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (+-)-7,2'-Dihydroxy-8,3',4'-trimethoxyisoflavan |
Common Name |
|
Symbol | |
Formula | C18H20O6 |
Exact Mass | 332.125988372 |
Average Mass | 332.3478 |
SMILES | c(c1O)(OC)c(OC)ccc1C(C3)Cc(c2O3)ccc(c2OC)O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
[show] Species-Flavonoid Relationship Reported |
---|