FL63CCNS0001
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=(2R)-2alpha-(3,4-Dihydroxyphenyl)-7-methoxy-3,4-dihydro-2H-1-benzopyran-3beta,5-diol | + | |SysName= (2R) -2alpha- (3,4-Dihydroxyphenyl) -7-methoxy-3,4-dihydro-2H-1-benzopyran-3beta,5-diol |
| − | |Common Name=&&Catechin-7-methyl ether&&(2R)-2alpha-(3,4-Dihydroxyphenyl)-7-methoxy-3,4-dihydro-2H-1-benzopyran-3beta,5-diol&& | + | |Common Name=&&Catechin-7-methyl ether&& (2R) -2alpha- (3,4-Dihydroxyphenyl) -7-methoxy-3,4-dihydro-2H-1-benzopyran-3beta,5-diol&& |
|CAS=- | |CAS=- | ||
|KNApSAcK=C00013258 | |KNApSAcK=C00013258 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | - |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63CCNS0001.mol |
| Catechin-7-methyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R) -2alpha- (3,4-Dihydroxyphenyl) -7-methoxy-3,4-dihydro-2H-1-benzopyran-3beta,5-diol |
| Common Name |
|
| Symbol | |
| Formula | C16H16O6 |
| Exact Mass | 304.094688244 |
| Average Mass | 304.29463999999996 |
| SMILES | COc(c1)cc(O2)c(CC(O)C2c(c3)cc(O)c(O)c3)c(O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
