FL5FEANS0002
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=2-(4-Methoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one | |SysName=2-(4-Methoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one | ||
− | |Common Name=&&Santin&& | + | |Common Name=&&Santin&&2-(4-Methoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=27782-63-4 | |CAS=27782-63-4 | ||
|KNApSAcK=C00001096 | |KNApSAcK=C00001096 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 27782-63-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FEANS0002.mol |
Santin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2-(4-Methoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C18H16O7 |
Exact Mass | 344.089602866 |
Average Mass | 344.31543999999997 |
SMILES | c(c3OC)(O)cc(O1)c(c3O)C(C(=C1c(c2)ccc(OC)c2)OC)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |