FL5FDBNS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=Kaempferol 3,7,4'-trimethyl ether | + | |SysName=Kaempferol 3,7,4'-trimethyl ether |
|Common Name=&&Kaempferol 3,7,4'-trimethyl ether&&5-Hydroxy-3,7,4'-trimethoxyflavone&&5-Hydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Kaempferol 3,7,4'-trimethyl ether&&5-Hydroxy-3,7,4'-trimethoxyflavone&&5-Hydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=15486-34-7 | |CAS=15486-34-7 | ||
|KNApSAcK=C00004573 | |KNApSAcK=C00004573 | ||
}} | }} | ||
Revision as of 09:00, 10 March 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 15486-34-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FDBNS0002.mol |
| Kaempferol 3,7,4'-trimethyl ether | |
|---|---|
| |
| Structural Information | |
| Systematic Name | Kaempferol 3,7,4'-trimethyl ether |
| Common Name |
|
| Symbol | |
| Formula | C18H16O6 |
| Exact Mass | 328.094688244 |
| Average Mass | 328.31604 |
| SMILES | c(c21)(O)cc(OC)cc(OC(c(c3)ccc(OC)c3)=C(C2=O)OC)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
