FL5FBGNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
|SysName=3,7,3',4',5'-Pentahydroxy-5-methoxyflavone  | |SysName=3,7,3',4',5'-Pentahydroxy-5-methoxyflavone  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FBG Myricetin 5-methyl ether (4 pages) : FL5FBGNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 19077-84-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FBGNS0001.mol | 
| Myricetin 5-methyl ether | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,7,3',4',5'-Pentahydroxy-5-methoxyflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C16H12O8 | 
| Exact Mass | 332.05321735999996 | 
| Average Mass | 332.26168 | 
| SMILES |  COc(c3)c(C(=O)2)c(cc(O)3)OC(=C(O)2)c(c1)cc(O)c(O)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
