FL5FALNS0010
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 135463-10-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FALNS0010.mol | 
| Chrysosplenol F | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 5,2',4'-Trihydroxy-3,7,5'-trimethoxyflavone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C18H16O8 | 
| Exact Mass | 360.08451748799996 | 
| Average Mass | 360.31484 | 
| SMILES |  c(c(C(O2)=C(C(c(c(O)3)c2cc(OC)c3)=O)OC)1)(O)cc(O)c | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
