FL2F9CNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 1: | Line 1: | ||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |Sysname=6,3',4'-Trimethoxyflavanone  | 
|Common Name=&&6,3',4'-Trimethoxyflavanone&&  | |Common Name=&&6,3',4'-Trimethoxyflavanone&&  | ||
|CAS=77822-21-0  | |CAS=77822-21-0  | ||
|KNApSAcK=C00008275  | |KNApSAcK=C00008275  | ||
}}  | }}  | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 77822-21-0 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F9CNS0001.mol | 
| 6,3',4'-Trimethoxyflavanone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | |
| Common Name | 
  | 
| Symbol | |
| Formula | C18H18O5 | 
| Exact Mass | 314.115423686 | 
| Average Mass | 314.33252 | 
| SMILES | C(c12)(=O)CC(c(c3)cc(OC)c(OC)c3)Oc1ccc(OC)c2 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
