FL1DRTNS0005
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=1-(4-Hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-1-propanone | + | |SysName=1- (4-Hydroxyphenyl) -3- (2,4,6-trimethoxyphenyl) -1-propanone |
− | |Common Name=&&Loureirin B&&1-(4-Hydroxyphenyl)-3-(2,4,6-trimethoxyphenyl)-1-propanone&& | + | |Common Name=&&Loureirin B&&1- (4-Hydroxyphenyl) -3- (2,4,6-trimethoxyphenyl) -1-propanone&& |
|CAS=119425-90-0 | |CAS=119425-90-0 | ||
|KNApSAcK=C00007933 | |KNApSAcK=C00007933 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 119425-90-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1DRTNS0005.mol |
Loureirin B | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 1- (4-Hydroxyphenyl) -3- (2,4,6-trimethoxyphenyl) -1-propanone |
Common Name |
|
Symbol | |
Formula | C18H20O5 |
Exact Mass | 316.13107375 |
Average Mass | 316.3484 |
SMILES | c(c1CCC(=O)c(c2)ccc(O)c2)(OC)cc(OC)cc1OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|