LBF18106HO01
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
+ | {{Hierarchy|{{PAGENAME}}}} | ||
+ | |||
{{Metabolite | {{Metabolite | ||
|LipidBank=DFA0373 | |LipidBank=DFA0373 |
Latest revision as of 09:00, 1 October 2008
Upper classes
IDs and Links | |
---|---|
LipidBank | DFA0373 |
LipidMaps | LMFA01050107 |
CAS | |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | LBF18106HO01.mol |
![]() | |
Structural Information | |
Systematic Name | 9-Hydroxy-cis-12-octadecenoic acid |
Common Name | |
Symbol | |
Formula | C18H34O3 |
Exact Mass | 298.25079495399996 |
Average Mass | 298.46076 |
SMILES | CCCCCC=CCCC(O)CCCCCCCC(O)=O |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | soluble in acetone, ethanol, ether. <<0063>>/<<0204>>/<<0205>>/<<0206>> |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |