FLIE1CNS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
|SysName=7,12-Dihydroxy-11-methoxycoumestan | |SysName=7,12-Dihydroxy-11-methoxycoumestan | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIE Coumestan : FLIE1C 3,8,9-Trihydroxycoumestan O-methyl derivatives (7 pages) : FLIE1CNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 13360-66-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIE1CNS0002.mol |
| 3'-Methoxycoumestrol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7,12-Dihydroxy-11-methoxycoumestan |
| Common Name |
|
| Symbol | |
| Formula | C16H10O6 |
| Exact Mass | 298.047738052 |
| Average Mass | 298.24699999999996 |
| SMILES | COc(c(O)4)cc(c(c4)3)c(C(=O)1)c(o3)c(c2)c(cc(O)c2)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
