FLID1CGS0003
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=3-Hydroxy-8,9-methylenedioxypterocarpan 3-O-galactoside | |SysName=3-Hydroxy-8,9-methylenedioxypterocarpan 3-O-galactoside | ||
| − | |Common Name=&&Maackiain 3-O-galactoside&& | + | |Common Name=&&Maackiain 3-O-galactoside&&3-Hydroxy-8,9-methylenedioxypterocarpan 3-O-galactoside&& |
|CAS=114761-94-3 | |CAS=114761-94-3 | ||
|KNApSAcK=C00010187 | |KNApSAcK=C00010187 | ||
}} | }} | ||
Revision as of 09:00, 15 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 114761-94-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLID1CGS0003.mol |
| Maackiain 3-O-galactoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3-Hydroxy-8,9-methylenedioxypterocarpan 3-O-galactoside |
| Common Name |
|
| Symbol | |
| Formula | C22H22O10 |
| Exact Mass | 446.121296924 |
| Average Mass | 446.40408 |
| SMILES | c(c1)c(O[C@@H]([C@@H](O)6)OC(CO)[C@H](O)[C@@H]6O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
