FL63AANM0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3 | + | |SysName= (2R,4S) -3,4-Dihydro-2alpha- (4-hydroxyphenyl) -3alpha,5,7-trihydroxy-2H-1-benzopyran-4-acetic acid |
| − | |Common Name=&&3'-Deoxydryopteric acid&& | + | |Common Name=&&3'-Deoxydryopteric acid&& (2R,4S) -3,4-Dihydro-2alpha- (4-hydroxyphenyl) -3alpha,5,7-trihydroxy-2H-1-benzopyran-4-acetic acid&& |
|CAS=156521-53-8 | |CAS=156521-53-8 | ||
|KNApSAcK=C00009316 | |KNApSAcK=C00009316 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AA Afzelechin and Epiafzelechin (13 pages) : FL63AANM C-Methyl or C2/C3 substituted (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 156521-53-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AANM0001.mol |
| 3'-Deoxydryopteric acid | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,4S) -3,4-Dihydro-2alpha- (4-hydroxyphenyl) -3alpha,5,7-trihydroxy-2H-1-benzopyran-4-acetic acid |
| Common Name |
|
| Symbol | |
| Formula | C17H16O7 |
| Exact Mass | 332.089602866 |
| Average Mass | 332.30474 |
| SMILES | OC(=O)CC(C(O)1)c(c(O)3)c(cc(O)c3)OC(c(c2)ccc(O)c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
