FL5FACGS0019
From Metabolomics.JP
(Difference between revisions)
| (9 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=3,5,7,3',4'-Pentahydroxyflavone 4'-glucoside |
| − | |Common Name=&&Spiraeoside&& | + | |Common Name=&&Spiraeoside&&Quercetin 4'-glucoside&&Spiraein&& |
|CAS=20229-56-5 | |CAS=20229-56-5 | ||
|KNApSAcK=C00005387 | |KNApSAcK=C00005387 | ||
}} | }} | ||
Latest revision as of 16:26, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAC Quercetin (289 pages) : FL5FACGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (126 pages) : FL5FACGS0 Normal (121 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 20229-56-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FACGS0019.mol |
| Spiraeoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7,3',4'-Pentahydroxyflavone 4'-glucoside |
| Common Name |
|
| Symbol | |
| Formula | C21H20O12 |
| Exact Mass | 464.095476104 |
| Average Mass | 464.37629999999996 |
| SMILES | c(c1)c(OC(O4)C(O)C(O)C(O)C4CO)c(O)cc1C(=C3O)Oc(c2) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
