FL3FCACS0002
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=8-alpha-L-Arabinopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | + | |SysName=8-alpha-L-Arabinopyranosyl-5-hydroxy-2- (4-hydroxyphenyl) -7-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Molludistin&&8-alpha-L-Arabinopyranosyl-5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Molludistin&&8-alpha-L-Arabinopyranosyl-5-hydroxy-2- (4-hydroxyphenyl) -7-methoxy-4H-1-benzopyran-4-one&& |
|CAS=66274-25-7 | |CAS=66274-25-7 | ||
|KNApSAcK=C00006102 | |KNApSAcK=C00006102 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FCA Genkwanin (48 pages) : FL3FCACS C-Glycoside (32 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 66274-25-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FCACS0002.mol |
| Molludistin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 8-alpha-L-Arabinopyranosyl-5-hydroxy-2- (4-hydroxyphenyl) -7-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C21H20O9 |
| Exact Mass | 416.11073223799997 |
| Average Mass | 416.37809999999996 |
| SMILES | c(C(=O)4)(c(O)2)c(OC(=C4)c(c3)ccc(O)c3)c(c(c2)OC)C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
