FL3FA9GS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
| − | |SysName=  | + | |SysName=5- (beta-D-Glucopyranosyloxy) -7-hydroxy-2-phenyl-4H-1-benzopyran-4-one  | 
| − | |Common Name=&&Toringin&&  | + | |Common Name=&&Toringin&&5- (beta-D-Glucopyranosyloxy) -7-hydroxy-2-phenyl-4H-1-benzopyran-4-one&&  | 
|CAS=1329-10-8  | |CAS=1329-10-8  | ||
|KNApSAcK=C00004109  | |KNApSAcK=C00004109  | ||
}}  | }}  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA9 5,7,(3'),(5')-Hydroxyflavone O-methyl derivatives (53 pages) : FL3FA9GS O-Glycoside (7 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 1329-10-8 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA9GS0001.mol | 
| Toringin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 5- (beta-D-Glucopyranosyloxy) -7-hydroxy-2-phenyl-4H-1-benzopyran-4-one | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H20O9 | 
| Exact Mass | 416.11073223799997 | 
| Average Mass | 416.37809999999996 | 
| SMILES |  C(C1Oc(c4)c(C(=O)3)c(cc(O)4)OC(=C3)c(c2)cccc2)(O)C | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
