FL3F98NS0003
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5-Hydroxy-2'-methoxyflavone |
|Common Name=&&5-Hydroxy-2'-methoxyflavone&& | |Common Name=&&5-Hydroxy-2'-methoxyflavone&& | ||
|CAS=6665-71-0 | |CAS=6665-71-0 | ||
|KNApSAcK=C00003797 | |KNApSAcK=C00003797 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F98 (5),(6),(8),2',(3'),(5'),(6')-Hydroxyflavone O-methyl derivatives (15 pages) : FL3F98NS Simple substitution (15 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 6665-71-0 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F98NS0003.mol |
| 5-Hydroxy-2'-methoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5-Hydroxy-2'-methoxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C16H12O4 |
| Exact Mass | 268.073558872 |
| Average Mass | 268.26408 |
| SMILES | COc(c3)c(ccc3)C(=C1)Oc(c2)c(c(O)cc2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
