FL2FACNS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName= (S) -2- (3,4-Dihydroxyphenyl) -2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Eriodictyol&& | + | |Common Name=&&Eriodictyol&&Huazhongilexone&&3',4',5,7-Tetrahydroxyflavanone&& |
|CAS=552-58-9 | |CAS=552-58-9 | ||
|KNApSAcK=C00000960 | |KNApSAcK=C00000960 | ||
}} | }} | ||
Latest revision as of 16:04, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAC Eriodictyol (71 pages) : FL2FACNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 552-58-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FACNS0001.mol |
| Eriodictyol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2- (3,4-Dihydroxyphenyl) -2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O6 |
| Exact Mass | 288.063388116 |
| Average Mass | 288.25218 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(=O)CC([H])1c(c2)cc(O)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
