FL1C3CNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (3 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
| {{Metabolite | {{Metabolite | ||
| − | |SysName=(E)-3-(3,4-Dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)-2-propen-1-one | + | |SysName= (E) -3- (3,4-Dihydroxyphenyl) -1- (2,3,4-trihydroxyphenyl) -2-propen-1-one | 
| − | |Common Name=&&Okanin&& | + | |Common Name=&&Okanin&& (E) -3- (3,4-Dihydroxyphenyl) -1- (2,3,4-trihydroxyphenyl) -2-propen-1-one&& | 
| |CAS=484-76-4 | |CAS=484-76-4 | ||
| |KNApSAcK=C00006969 | |KNApSAcK=C00006969 | ||
| }} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL1 Aurone and Chalcone : FL1C Chalcone : FL1C3C Okanin and O-methyl derivatives (29 pages) : FL1C3CNS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 484-76-4 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C3CNS0001.mol | 
| Okanin | |
|---|---|
|   | |
| Structural Information | |
| Systematic Name | (E) -3- (3,4-Dihydroxyphenyl) -1- (2,3,4-trihydroxyphenyl) -2-propen-1-one | 
| Common Name | 
 | 
| Symbol | |
| Formula | C15H12O6 | 
| Exact Mass | 288.063388116 | 
| Average Mass | 288.25218 | 
| SMILES | Oc(c2)c(O)cc(c2)C=CC(=O)c(c1)c(O)c(O)c(O)c1 | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
