Barbaloin
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| Line 2: | Line 2: | ||
{{Metabolite  | {{Metabolite  | ||
| − | |SysName=(10S)-10-  | + | |SysName=(10S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone  | 
| − | |Common Name=&&Barbaloin&&(S)-10-  | + | |Common Name=&&Barbaloin&&(S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone&&10-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-anthrone&&Aloin&&Aloin A&&Barbaloin A&&  | 
|CAS=1415-73-2  | |CAS=1415-73-2  | ||
|KNApSAcK=  | |KNApSAcK=  | ||
}}  | }}  | ||
Latest revision as of 15:24, 18 December 2009
Upper classes
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 1415-73-2 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | Barbaloin.mol | 
| Barbaloin | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | (10S)-10-beta-D-Glucopyranosyl-1,8-dihydroxy-3-(hydroxymethyl)-9(10H)-anthracenone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H22O9 | 
| Exact Mass | 418.126382302 | 
| Average Mass | 418.39398 | 
| SMILES |  OCc(c4)cc(c(c(O)4)2)C([H])(c(c3)c(c(O)cc3)C(=O)2)C | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
