Phyllodulcin
From Metabolomics.JP
(Difference between revisions)
(One intermediate revision by one user not shown) | |||
Line 2: | Line 2: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName= | + | |SysName=(3R)-3,4-Dihydro-8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-1H-2-benzopyran-1-one |
− | |Common Name=&&&& | + | |Common Name=&&Phyllodulcin&&(R)-3,4-Dihydro-8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-d-phyllodulcin&&1H-2-Benzopyran-1-one&&3,4-Dihydro-8-hydroxy-3beta-(3-hydroxy-4-methoxyphenyl)-isocoumarin&&(+)-Phyllodulcin&&(R)-(+)-Phyllodulcin&&3R-Phyllodulcin&&8-Hydroxy-3-(3-hydroxy-4-methoxyphenyl)dihydroisocoumarin&& |
|CAS=21499-23-0 | |CAS=21499-23-0 | ||
|KNApSAcK= | |KNApSAcK= | ||
}} | }} | ||
=Mass Data= | =Mass Data= |
Latest revision as of 15:24, 18 December 2009
Upper classes
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 21499-23-0 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | Phyllodulcin.mol |
Phyllodulcin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (3R)-3,4-Dihydro-8-hydroxy-3-(3-hydroxy-4-methoxyphenyl)-1H-2-benzopyran-1-one |
Common Name |
|
Symbol | |
Formula | C16H14O5 |
Exact Mass | 286.084123558 |
Average Mass | 286.27936 |
SMILES | COc(c3)c(O)cc(c3)C(O1)Cc(c2)c(c(O)cc2)C(=O)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |