FLIA2AGS0003
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=7-(beta-D-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one | + | |SysName=7- (beta-D-Glucopyranosyloxy) -3- (4-hydroxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Glycitein 7-O-glucoside&&Glycitin&&7-(beta-D-Glucopyranosyloxy)-3-(4-hydroxyphenyl)-6-methoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Glycitein 7-O-glucoside&&Glycitin&&7- (beta-D-Glucopyranosyloxy) -3- (4-hydroxyphenyl) -6-methoxy-4H-1-benzopyran-4-one&& |
|CAS=40246-10-4 | |CAS=40246-10-4 | ||
|KNApSAcK=C00010089 | |KNApSAcK=C00010089 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FLI Isoflavonoid : FLIA Isoflavone : FLIA2A Demethyltexasin and O-methyl derivatives (11 pages) : FLIA2AGS O-Glycoside (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 40246-10-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FLIA2AGS0003.mol |
| Glycitein 7-O-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 7- (beta-D-Glucopyranosyloxy) -3- (4-hydroxyphenyl) -6-methoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C22H22O10 |
| Exact Mass | 446.121296924 |
| Average Mass | 446.40408 |
| SMILES | OC(C1O)C(Oc(c2)c(cc(C3=O)c2OC=C3c(c4)ccc(c4)O)OC)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
