FL6DAGNS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3,4,5,7,3',4',5'-Heptahydroxyflavan |
| − | |Common Name=&&Gallocatechin-4beta-ol&& | + | |Common Name=&&Gallocatechin-4beta-ol&&3,4,5,7,3',4',5'-Heptahydroxyflavan&&Leuco-delphinidin&& |
|CAS=89819-67-6 | |CAS=89819-67-6 | ||
|KNApSAcK=C00008992 | |KNApSAcK=C00008992 | ||
}} | }} | ||
Latest revision as of 12:28, 7 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL6D Flavan 3,4-diol : FL6DAG Leucodelphinidin (4 pages) : FL6DAGNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 89819-67-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL6DAGNS0001.mol |
| Gallocatechin-4beta-ol | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,4,5,7,3',4',5'-Heptahydroxyflavan |
| Common Name |
|
| Symbol | |
| Formula | C15H14O8 |
| Exact Mass | 322.068867424 |
| Average Mass | 322.26686 |
| SMILES | Oc(c3)cc(O1)c(c(O)3)C(O)C(O)C1c(c2)cc(O)c(O)c(O)2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
