FL63AANS0003
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 36801-69-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL63AANS0003.mol |
ent-Epiafzelechin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | [2S,3S,(+)]-3,4-Dihydro-2beta-(4-hydroxyphenyl)-2H-1-benzopyran-3beta,5,7-triol |
Common Name |
|
Symbol | |
Formula | C15H14O5 |
Exact Mass | 274.084123558 |
Average Mass | 274.26866 |
SMILES | Oc(c3)ccc(c3)C(O1)C(O)Cc(c(O)2)c(cc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|