FL63AANS0002
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName= (2R,3R) -3,4-Dihydro-2- (4-hydroxyphenyl) -2H-1-benzopyran-3,5,7-triol |
| − | |Common Name=&&Epiafzelechin&& | + | |Common Name=&&Epiafzelechin&& (2R,3R) -3,4-Dihydro-2- (4-hydroxyphenyl) -2H-1-benzopyran-3,5,7-triol&& |
|CAS=24808-04-6 | |CAS=24808-04-6 | ||
|KNApSAcK=C00008805 | |KNApSAcK=C00008805 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL6 Flavan : FL63 Flavan 3-ol : FL63AA Afzelechin and Epiafzelechin (13 pages) : FL63AANS Simple substitution (3 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 24808-04-6 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL63AANS0002.mol |
| Epiafzelechin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (2R,3R) -3,4-Dihydro-2- (4-hydroxyphenyl) -2H-1-benzopyran-3,5,7-triol |
| Common Name |
|
| Symbol | |
| Formula | C15H14O5 |
| Exact Mass | 274.084123558 |
| Average Mass | 274.26866 |
| SMILES | Oc(c3)ccc(c3)C(O1)C(O)Cc(c(O)2)c(cc(O)c2)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
