FL5FFANS0011
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3,5,7-Trihydroxy-8-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=3,5,7-Trihydroxy-8-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&3,5,7-Trihydroxy-4',8-dimethoxyflavone&&Prudomestin&&3,5,7-Trihydroxy-8-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&3,5,7-Trihydroxy-4',8-dimethoxyflavone&&Prudomestin&&3,5,7-Trihydroxy-8-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=3443-28-5 | |CAS=3443-28-5 | ||
|KNApSAcK=C00004618 | |KNApSAcK=C00004618 | ||
}} | }} | ||
Revision as of 09:00, 25 July 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 3443-28-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FFANS0011.mol |
| 3,5,7-Trihydroxy-4',8-dimethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3,5,7-Trihydroxy-8-methoxy-2- (4-methoxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C17H14O7 |
| Exact Mass | 330.073952802 |
| Average Mass | 330.28886 |
| SMILES | COc(c3)ccc(c3)C(O1)=C(O)C(=O)c(c(O)2)c1c(OC)c(O)c2 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
