FL5FECGS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
| − | |  | + | |SysName=3,5,6,7,3',4'-Hexahydroxyflavone 3-rhamnoside  | 
| − | |Common Name=&&Quercetagetin 3-rhamnoside&&  | + | |Common Name=&&Quercetagetin 3-rhamnoside&&3,5,6,7,3',4'-Hexahydroxyflavone 3-rhamnoside&&  | 
|CAS=64543-29-9  | |CAS=64543-29-9  | ||
|KNApSAcK=C00005632  | |KNApSAcK=C00005632  | ||
}}  | }}  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FEC Quercetagetin and O-methyl derivatives (150 pages) : FL5FECGS O-Glycoside (Without 3-glycoside and 3-galactoside related) (69 pages) : FL5FECGS0 Normal (68 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 64543-29-9 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FECGS0001.mol | 
| Quercetagetin 3-rhamnoside | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | 3,5,6,7,3',4'-Hexahydroxyflavone 3-rhamnoside | 
| Common Name | 
  | 
| Symbol | |
| Formula | C21H20O12 | 
| Exact Mass | 464.095476104 | 
| Average Mass | 464.37629999999996 | 
| SMILES |  O(C(C4=O)=C(Oc(c34)cc(O)c(c3O)O)c(c2)cc(c(O)c2)O)C | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
  | 
