FL5FACNI0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Gancaonin P | + | |SysName=Gancaonin P |
|Common Name=&&Gancaonin P&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | |Common Name=&&Gancaonin P&&2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one&& | ||
|CAS=129145-54-6 | |CAS=129145-54-6 | ||
|KNApSAcK=C00005012 | |KNApSAcK=C00005012 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 129145-54-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL5FACNI0001.mol |
Gancaonin P | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Gancaonin P |
Common Name |
|
Symbol | |
Formula | C20H18O7 |
Exact Mass | 370.10525293 |
Average Mass | 370.35272 |
SMILES | C(c(c3O)c(O)cc(c31)OC(c(c2)cc(c(O)c2)O)=C(C1=O)O)C |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|
|