FL5FABGI0007
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=3-(6-Deoxy-alpha-L-mannopyranosyloxy)-7-(beta-D-glucopyranosyloxy)-5-hydroxy-2-(4-methoxyphenyl)-8-(3-methyl-2-butenyl)-4H-1-benzopyran-4-one | + | |SysName=3- (6-Deoxy-alpha-L-mannopyranosyloxy) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-2- (4-methoxyphenyl) -8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Icariin&& | + | |Common Name=&&Icariin&&Ieariline&& |
|CAS=489-32-7 | |CAS=489-32-7 | ||
|KNApSAcK=C00005824 | |KNApSAcK=C00005824 | ||
}} | }} | ||
Latest revision as of 16:22, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL5 Flavonol : FL5FAB Kaempferide (50 pages) : FL5FABGI Non-cyclic prenyl substituted flavonoid O-glycoside (28 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 489-32-7 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL5FABGI0007.mol |
| Icariin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3- (6-Deoxy-alpha-L-mannopyranosyloxy) -7- (beta-D-glucopyranosyloxy) -5-hydroxy-2- (4-methoxyphenyl) -8- (3-methyl-2-butenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C33H40O15 |
| Exact Mass | 676.23672061 |
| Average Mass | 676.6617 |
| SMILES | C(C5O)(OC(C(O)C5O)CO)Oc(c(CC=C(C)C)1)cc(O)c(C3=O)c |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
