FL4DAHGS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=(2R,3R)-3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone 4'-rhamnoside | + | |SysName= (2R,3R) -3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone 4'-rhamnoside |
− | |Common Name=&&Ampelopsin 3'-methyl ether 4'-rhamnoside&&(2R,3R)-3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone 4'-rhamnoside&& | + | |Common Name=&&Ampelopsin 3'-methyl ether 4'-rhamnoside&& (2R,3R) -3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone 4'-rhamnoside&& |
|CAS=71106-80-4 | |CAS=71106-80-4 | ||
|KNApSAcK=C00008725 | |KNApSAcK=C00008725 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 71106-80-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DAHGS0001.mol |
Ampelopsin 3'-methyl ether 4'-rhamnoside | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2R,3R) -3,5,7,4',5'-Pentahydroxy-3'-methoxyflavanone 4'-rhamnoside |
Common Name |
|
Symbol | |
Formula | C22H24O12 |
Exact Mass | 480.126776232 |
Average Mass | 480.41876 |
SMILES | O(C)c(c2)c(c(cc(C(C3O)Oc(c4)c(c(O)cc4O)C3=O)2)O)OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|