FL4DAANS0001
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
|SysName=(2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | |SysName=(2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one | ||
− | |Common Name=&&(+)- | + | |Common Name=&&(+)-Aromadendrin&&(+)-Dihydrokaempferol&&Katuranin&&(2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one&& |
|CAS=480-20-6 | |CAS=480-20-6 | ||
|KNApSAcK=C00007234 | |KNApSAcK=C00007234 | ||
}} | }} |
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 480-20-6 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL4DAANS0001.mol |
(+)-Aromadendrin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C15H12O6 |
Exact Mass | 288.063388116 |
Average Mass | 288.25218 |
SMILES | Oc(c3)ccc(c3)C(O1)C(O)C(=O)c(c(O)2)c(cc(O)c2)1 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |