FL3FQUNP0002
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 186824-60-2 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FQUNP0002.mol |
Artonol D | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 6-Hydroxy-3,3,12,12-tetramethyl-9-(1-methylethenyl)-3H,7H,8H-[1]benzopyrano[7,6-c]pyrano[3,2-h]xanthene-7,10,15(9H,12H)-trione |
Common Name |
|
Symbol | |
Formula | C30H26O7 |
Exact Mass | 498.167853186 |
Average Mass | 498.52324 |
SMILES | c(c6=O)(C(C(C)=C)4)c(c(=O)c(c65)C=CC(O5)(C)C)C(O1) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|