FL3FACGS0012
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=3'- (beta-D-Xylopyranosyloxy) -4',5,7-trihydroxyflavone |
| − | |Common Name=&&Luteolin 3'-xyloside&& | + | |Common Name=&&Luteolin 3'-xyloside&&3'- (beta-D-Xylopyranosyloxy) -4',5,7-trihydroxyflavone&& |
|CAS=93078-91-2 | |CAS=93078-91-2 | ||
|KNApSAcK=C00004271 | |KNApSAcK=C00004271 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FAC Luteolin (194 pages) : FL3FACGS O-Glycoside (87 pages) : FL3FACGS0 Normal (84 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 93078-91-2 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FACGS0012.mol |
| Luteolin 3'-xyloside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 3'- (beta-D-Xylopyranosyloxy) -4',5,7-trihydroxyflavone |
| Common Name |
|
| Symbol | |
| Formula | C20H18O10 |
| Exact Mass | 418.089996796 |
| Average Mass | 418.35092 |
| SMILES | c(c2)(C(=C3)Oc(c4)c(c(cc(O)4)O)C(=O)3)cc(c(O)c2)OC |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
