FL3FAANP0007
From Metabolomics.JP
(Difference between revisions)
Revision as of 09:00, 15 May 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 57498-96-1 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FAANP0007.mol |
5,4'-Dihidroxy-6",6"-dimethylpyrano[2",3":7,6]flavone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 5-Hydroxy-8-(4-hydroxyphenyl)-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one |
Common Name |
|
Symbol | |
Formula | C20H16O5 |
Exact Mass | 336.099773622 |
Average Mass | 336.33804000000003 |
SMILES | C(=O)(C=3)c(c2O)c(OC3c(c4)ccc(O)c4)cc(c12)OC(C=C1) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|