FL3FA9NS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=Tectochrysin | + | |SysName=Tectochrysin |
|Common Name=&&Tectochrysin&&5-hydroxy-7-methoxyflavone&& | |Common Name=&&Tectochrysin&&5-hydroxy-7-methoxyflavone&& | ||
|CAS=520-28-5 | |CAS=520-28-5 | ||
|KNApSAcK=C00003795 | |KNApSAcK=C00003795 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 520-28-5 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3FA9NS0003.mol |
Tectochrysin | |
---|---|
![]() | |
Structural Information | |
Systematic Name | Tectochrysin |
Common Name |
|
Symbol | |
Formula | C16H12O4 |
Exact Mass | 268.073558872 |
Average Mass | 268.26408 |
SMILES | COc(c3)cc(O1)c(c(O)3)C(=O)C=C1c(c2)cccc2 |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |