FL3FA8NS0007
From Metabolomics.JP
(Difference between revisions)
| (2 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(2,5-Dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one | + | |SysName=2- (2,5-Dihydroxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,7,2',5'-Tetrahydroxyflavone&&2-(2,5-Dihydroxyphenyl)-5,7-dihydroxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,7,2',5'-Tetrahydroxyflavone&&2- (2,5-Dihydroxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one&& |
|CAS=74805-72-4 | |CAS=74805-72-4 | ||
|KNApSAcK=C00013305 | |KNApSAcK=C00013305 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3FA8 5,7,2',(3'),(5'),(6')-Hydroxyflavone O-methyl derivatives (21 pages) : FL3FA8NS Simple substitution (12 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 74805-72-4 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3FA8NS0007.mol |
| 5,7,2',5'-Tetrahydroxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (2,5-Dihydroxyphenyl) -5,7-dihydroxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H10O6 |
| Exact Mass | 286.047738052 |
| Average Mass | 286.2363 |
| SMILES | Oc(c3)cc(c(O)c3)C(=C1)Oc(c2)c(c(O)cc(O)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
