FL3F9GNS0003
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=2-(3,4,5-Trimethoxyphenyl)-4H-1-benzopyran-4-one | + | |SysName=2- (3,4,5-Trimethoxyphenyl) -4H-1-benzopyran-4-one |
− | |Common Name=&&3',4',5'-Trimethoxyflavone&&2-(3,4,5-Trimethoxyphenyl)-4H-1-benzopyran-4-one&& | + | |Common Name=&&3',4',5'-Trimethoxyflavone&&2- (3,4,5-Trimethoxyphenyl) -4H-1-benzopyran-4-one&& |
|CAS=67858-30-4 | |CAS=67858-30-4 | ||
|KNApSAcK=C00013299 | |KNApSAcK=C00013299 | ||
}} | }} |
Revision as of 09:00, 25 July 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | 67858-30-4 |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL3F9GNS0003.mol |
3',4',5'-Trimethoxyflavone | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 2- (3,4,5-Trimethoxyphenyl) -4H-1-benzopyran-4-one |
Common Name |
|
Symbol | |
Formula | C18H16O5 |
Exact Mass | 312.099773622 |
Average Mass | 312.31664 |
SMILES | c(c1OC)(OC)cc(C(=C3)Oc(c2C(=O)3)cccc2)cc1OC |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
[show] Species-Flavonoid Relationship Reported |
---|