FL3F99NS0009
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=2-(3,5-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one | + | |SysName=2- (3,5-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&5,6,3',5'-tetramethoxyflavone&&Cerrosillin&&2-(3,5-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&5,6,3',5'-tetramethoxyflavone&&Cerrosillin&&2- (3,5-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=17182-56-8 | |CAS=17182-56-8 | ||
|KNApSAcK=C00003858 | |KNApSAcK=C00003858 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F99 (5),(6),(8),(3'),(5')-Hydroxyflavone O-methyl derivatives (9 pages) : FL3F99NS Simple substitution (8 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 17182-56-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F99NS0009.mol |
| 5,6,3',5'-tetramethoxyflavone | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (3,5-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O6 |
| Exact Mass | 342.110338308 |
| Average Mass | 342.34262 |
| SMILES | c(c3OC)(OC)ccc(c13)OC(c(c2)cc(OC)cc(OC)2)=CC1=O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
