FL3F98NS0012
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=2- (2,6-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one |
| − | |Common Name=&&Zapotin&&2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one&& | + | |Common Name=&&Zapotin&&2- (2,6-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one&& |
|CAS=14813-19-5 | |CAS=14813-19-5 | ||
|KNApSAcK=C00003857 | |KNApSAcK=C00003857 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL3 Flavone : FL3F98 (5),(6),(8),2',(3'),(5'),(6')-Hydroxyflavone O-methyl derivatives (15 pages) : FL3F98NS Simple substitution (15 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 14813-19-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL3F98NS0012.mol |
| Zapotin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 2- (2,6-Dimethoxyphenyl) -5,6-dimethoxy-4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C19H18O6 |
| Exact Mass | 342.110338308 |
| Average Mass | 342.34262 |
| SMILES | c(c1OC)(OC)ccc(O2)c(C(=O)C=C2c(c(OC)3)c(OC)ccc3)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
