FL2FDCNS0001
From Metabolomics.JP
				
								
				(Difference between revisions)
				
																
				
				
								
				| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}}  | ||
| + | |||
{{Metabolite  | {{Metabolite  | ||
| − | |SysName=(2S)-5,7-Dimethoxy-3',4'-methylenedioxyflavanone  | + | |SysName= (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone  | 
| − | |Common Name=&&(2S)-5,7-Dimethoxy-3',4'-methylenedioxyflavanone&&  | + | |Common Name=&& (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone&&  | 
|CAS=610770-50-8  | |CAS=610770-50-8  | ||
|KNApSAcK=C00014128  | |KNApSAcK=C00014128  | ||
}}  | }}  | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input | 
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FDC 5,7-Dimethoxy-3',4'-hydroxyflavanone (0 pages) : FL2FDCNS Simple substitution (0 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] | 
| LipidMaps | [2] | 
| CAS | 610770-50-8 | 
| KEGG | {{{KEGG}}} | 
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FDCNS0001.mol | 
| (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone | |
|---|---|
  
 | |
| Structural Information | |
| Systematic Name | (2S) -5,7-Dimethoxy-3',4'-methylenedioxyflavanone | 
| Common Name | 
  | 
| Symbol | |
| Formula | C18H16O6 | 
| Exact Mass | 328.094688244 | 
| Average Mass | 328.31604 | 
| SMILES | O(C(c(c4)cc(c3c4)OCO3)2)c(c(C(=O)C2)1)cc(OC)cc1OC | 
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
  | 
