FL2FADNI0005
From Metabolomics.JP
(Difference between revisions)
| (One intermediate revision by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName=5,7,4'-Trihydroxy-3'-methoxy-6-(beta-hydroxyethyl)-8-prenylflavanone | + | |SysName=5,7,4'-Trihydroxy-3'-methoxy-6- (beta-hydroxyethyl) -8-prenylflavanone |
| − | |Common Name=&&Laxiflorin&&5,7,4'-Trihydroxy-3'-methoxy-6-(beta-hydroxyethyl)-8-prenylflavanone&& | + | |Common Name=&&Laxiflorin&&5,7,4'-Trihydroxy-3'-methoxy-6- (beta-hydroxyethyl) -8-prenylflavanone&& |
|CAS=180680-91-5 | |CAS=180680-91-5 | ||
|KNApSAcK=C00014171 | |KNApSAcK=C00014171 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAD Homoeriodictyol (17 pages) : FL2FADNI Non-cyclic prenyl substituted (5 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 180680-91-5 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FADNI0005.mol |
| Laxiflorin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxy-3'-methoxy-6- (beta-hydroxyethyl) -8-prenylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C23H26O7 |
| Exact Mass | 414.167853186 |
| Average Mass | 414.44834000000003 |
| SMILES | c(c23)(c(c(CCO)c(c3CC=C(C)C)O)O)C(=O)CC(O2)c(c1)cc |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
