FL2FACNI0012
From Metabolomics.JP
(Difference between revisions)
| (4 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=5,7,3'-Trihydroxy-4'-O-prenylflavanone |
|Common Name=&&Monotesone A&&5,7,3'-Trihydroxy-4'-O-prenylflavanone&& | |Common Name=&&Monotesone A&&5,7,3'-Trihydroxy-4'-O-prenylflavanone&& | ||
|CAS=208596-55-8 | |CAS=208596-55-8 | ||
|KNApSAcK=C00014165 | |KNApSAcK=C00014165 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAC Eriodictyol (71 pages) : FL2FACNI Non-cyclic prenyl substituted (23 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 208596-55-8 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FACNI0012.mol |
| Monotesone A | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,3'-Trihydroxy-4'-O-prenylflavanone |
| Common Name |
|
| Symbol | |
| Formula | C20H20O6 |
| Exact Mass | 356.125988372 |
| Average Mass | 356.3692 |
| SMILES | c(c1)c(c(O)cc1C(C2)Oc(c3)c(c(cc(O)3)O)C(=O)2)OCC=C |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
