FL2FAAGS0023
From Metabolomics.JP
(Difference between revisions)
| (6 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | |SysName= | + | |SysName=5,7,4'-Trihydroxyflavanone 7- (6-acetylglucoside) |
| − | |Common Name=&&Naringenin 7-O-beta-D-glucoside 6"-acetate&&5,7,4'-Trihydroxyflavanone 7-(6-acetylglucoside)&& | + | |Common Name=&&Naringenin 7-O-beta-D-glucoside 6"-acetate&&5,7,4'-Trihydroxyflavanone 7- (6-acetylglucoside) && |
|CAS=252324-55-3 | |CAS=252324-55-3 | ||
|KNApSAcK=C00014317 | |KNApSAcK=C00014317 | ||
}} | }} | ||
Latest revision as of 09:00, 22 September 2008
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2FAA Naringenin (106 pages) : FL2FAAGS O-Glycoside (27 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 252324-55-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2FAAGS0023.mol |
| Naringenin 7-O-beta-D-glucoside 6"-acetate | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 5,7,4'-Trihydroxyflavanone 7- (6-acetylglucoside) |
| Common Name |
|
| Symbol | |
| Formula | C23H24O11 |
| Exact Mass | 476.13186161 |
| Average Mass | 476.43006 |
| SMILES | OC(C1O)C(Oc(c4)cc(c(c4O)2)OC(c(c3)ccc(c3)O)CC2=O)O |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
