FL2F1ANS0001
From Metabolomics.JP
(Difference between revisions)
| (5 intermediate revisions by one user not shown) | |||
| Line 1: | Line 1: | ||
| + | {{Hierarchy|{{PAGENAME}}}} | ||
| + | |||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName= (S) -2,3-Dihydro-7-hydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| − | |Common Name=&&Liquiritigenin&& | + | |Common Name=&&Liquiritigenin&&4',7-Dihydroxyflavanone&& |
|CAS=578-86-9 | |CAS=578-86-9 | ||
|KNApSAcK=C00000977 | |KNApSAcK=C00000977 | ||
}} | }} | ||
Latest revision as of 16:00, 5 January 2010
| Flavonoid Top | Molecule Index | Author Index | Journals | Structure Search | Food | New Input |
Upper classes : FL Flavonoid : FL2 Flavanone : FL2F1A Liquiritigenin and O-methyl derivatives (43 pages) : FL2F1ANS Simple substitution (2 pages)
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 578-86-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL2F1ANS0001.mol |
| Liquiritigenin | |
|---|---|
| |
| Structural Information | |
| Systematic Name | (S) -2,3-Dihydro-7-hydroxy-2- (4-hydroxyphenyl) -4H-1-benzopyran-4-one |
| Common Name |
|
| Symbol | |
| Formula | C15H12O4 |
| Exact Mass | 256.073558872 |
| Average Mass | 256.25338 |
| SMILES | Oc(c3)ccc(c3)C([H])(C1)Oc(c2)c(ccc(O)2)C(=O)1 |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
