FL1CHYNP0010
From Metabolomics.JP
(Difference between revisions)
Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
− | |SysName=7-Methoxypraecansone B | + | |SysName=7-Methoxypraecansone B |
|Common Name=&&7-Methoxypraecansone B&&6",6"-Dimethylpyrano[2",3":4',3']-2',6',beta-trimethoxychalcone&& | |Common Name=&&7-Methoxypraecansone B&&6",6"-Dimethylpyrano[2",3":4',3']-2',6',beta-trimethoxychalcone&& | ||
|CAS=- | |CAS=- | ||
|KNApSAcK=C00014493 | |KNApSAcK=C00014493 | ||
}} | }} |
Revision as of 09:00, 10 March 2008
IDs and Links | |
---|---|
LipidBank | [1] |
LipidMaps | [2] |
CAS | - |
KEGG | {{{KEGG}}} |
KNApSAcK | |
CDX file | |
MOL file | FL1CHYNP0010.mol |
7-Methoxypraecansone B | |
---|---|
![]() | |
Structural Information | |
Systematic Name | 7-Methoxypraecansone B |
Common Name |
|
Symbol | |
Formula | C23H24O5 |
Exact Mass | 380.162373878 |
Average Mass | 380.43366000000003 |
SMILES | c(c31)(C=CC(O3)(C)C)c(OC)c(C(C=C(OC)c(c2)cccc2)=O) |
Physicochemical Information | |
Melting Point | |
Boiling Point | |
Density | |
Optical Rotation | |
Reflactive Index | |
Solubility | |
Spectral Information | |
Mass Spectra | |
UV Spectra | |
IR Spectra | |
NMR Spectra | |
Chromatograms |
Species Information
Species-Flavonoid Relationship Reported | ||||||||
---|---|---|---|---|---|---|---|---|
|