FL1CHYGS0002
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |Sysname=2',4',6',beta-Tetrahydroxychalcone 4'-glucoside |
|Common Name=&&2',4',6',beta-Tetrahydroxychalcone 4'-glucoside&& | |Common Name=&&2',4',6',beta-Tetrahydroxychalcone 4'-glucoside&& | ||
|CAS=50634-04-3 | |CAS=50634-04-3 | ||
|KNApSAcK=C00007891 | |KNApSAcK=C00007891 | ||
}} | }} | ||
Revision as of 09:00, 12 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 50634-04-3 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1CHYGS0002.mol |
| 2',4',6',beta-Tetrahydroxychalcone 4'-glucoside | |
|---|---|
| |
| Structural Information | |
| Systematic Name | |
| Common Name |
|
| Symbol | |
| Formula | C21H22O10 |
| Exact Mass | 434.121296924 |
| Average Mass | 434.39338 |
| SMILES | [C@@H](O1)(Oc(c2)cc(c(C(CC(=O)c(c3)cccc3)=O)c2O)O) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
