FL1C1ANP0020
From Metabolomics.JP
(Difference between revisions)
| Line 1: | Line 1: | ||
{{Metabolite | {{Metabolite | ||
| − | | | + | |SysName=6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":2',3']-4'-hydroxy-4'-methoxychalcone |
|Common Name=&&Xanthoangelol H&&6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":2',3']-4'-hydroxy-4'-methoxychalcone&& | |Common Name=&&Xanthoangelol H&&6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":2',3']-4'-hydroxy-4'-methoxychalcone&& | ||
|CAS=265652-89-9 | |CAS=265652-89-9 | ||
|KNApSAcK=C00014468 | |KNApSAcK=C00014468 | ||
}} | }} | ||
Revision as of 09:00, 13 May 2008
| IDs and Links | |
|---|---|
| LipidBank | [1] |
| LipidMaps | [2] |
| CAS | 265652-89-9 |
| KEGG | {{{KEGG}}} |
| KNApSAcK | |
| CDX file | |
| MOL file | FL1C1ANP0020.mol |
| Xanthoangelol H | |
|---|---|
| |
| Structural Information | |
| Systematic Name | 6",6"-Dimethyl-5"-hydroxy-4",5"-dihydropyrano[2",3":2',3']-4'-hydroxy-4'-methoxychalcone |
| Common Name |
|
| Symbol | |
| Formula | C21H22O5 |
| Exact Mass | 354.146723814 |
| Average Mass | 354.39638 |
| SMILES | O(C(C)(C)2)c(c1C(=O)C=Cc(c3)ccc(O)c3)c(CC2O)c(cc1) |
| Physicochemical Information | |
| Melting Point | |
| Boiling Point | |
| Density | |
| Optical Rotation | |
| Reflactive Index | |
| Solubility | |
| Spectral Information | |
| Mass Spectra | |
| UV Spectra | |
| IR Spectra | |
| NMR Spectra | |
| Chromatograms | |
Species Information
| Species-Flavonoid Relationship Reported | ||||||||
|---|---|---|---|---|---|---|---|---|
|
